C26H36N2O2S2 — CID 169316121
6,8-bis(benzylsulfanyl)-3-deuterio-3-hydroxy-1-piperazin-1-yloctan-1-one (PubChem CID 169316121) has the molecular formula C26H36N2O2S2 and a molecular weight of 473.73 g/mol. Its IUPAC name is 6,8-bis(benzylsulfanyl)-3-deuterio-3-hydroxy-1-piperazin-1-yloctan-1-one.
| Compound Name | 6,8-bis(benzylsulfanyl)-3-deuterio-3-hydroxy-1-piperazin-1-yloctan-1-one |
|---|---|
| PubChem CID | 169316121 |
| Molecular Formula | C26H36N2O2S2 |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 6,8-bis(benzylsulfanyl)-3-deuterio-3-hydroxy-1-piperazin-1-yloctan-1-one |
| SMILES | [2H]C(O)(CCC(CCSCc1ccccc1)SCc1ccccc1)CC(=O)N1CCNCC1 |
| InChI | InChI=1S/C26H36N2O2S2/c29-24(19-26(30)28-16-14-27-15-17-28)11-12-25(32-21-23-9-5-2-6-10-23)13-18-31-20-22-7-3-1-4-8-22/h1-10,24-25,27,29H,11-21H2/i24D |
| InChIKey | PJTRPUJYNYIDAD-CORJAIEOSA-N |
| XLogP | 4.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|