C20H29NO2S — CID 14899705
3-cyclohexyl-3-hydroxy-2-phenylsulfanyl-1-piperidin-1-ylpropan-1-one (PubChem CID 14899705) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is 3-cyclohexyl-3-hydroxy-2-phenylsulfanyl-1-piperidin-1-ylpropan-1-one.
| Compound Name | 3-cyclohexyl-3-hydroxy-2-phenylsulfanyl-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 14899705 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-cyclohexyl-3-hydroxy-2-phenylsulfanyl-1-piperidin-1-ylpropan-1-one |
| SMILES | O=C(C(Sc1ccccc1)C(O)C1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C20H29NO2S/c22-18(16-10-4-1-5-11-16)19(24-17-12-6-2-7-13-17)20(23)21-14-8-3-9-15-21/h2,6-7,12-13,16,18-19,22H,1,3-5,8-11,14-15H2 |
| InChIKey | PETZZCGGFCBULB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |