C19H30NO2S+ — CID 66821576
1-(4-ethyl-2-hydroxy-1-methyl-5-phenylsulfanylpiperidin-1-ium-1-yl)pentan-1-one (PubChem CID 66821576) has the molecular formula C19H30NO2S+ and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-(4-ethyl-2-hydroxy-1-methyl-5-phenylsulfanylpiperidin-1-ium-1-yl)pentan-1-one.
| Compound Name | 1-(4-ethyl-2-hydroxy-1-methyl-5-phenylsulfanylpiperidin-1-ium-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 66821576 |
| Molecular Formula | C19H30NO2S+ |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-(4-ethyl-2-hydroxy-1-methyl-5-phenylsulfanylpiperidin-1-ium-1-yl)pentan-1-one |
| SMILES | CCCCC(=O)[N+]1(C)CC(Sc2ccccc2)C(CC)CC1O |
| InChI | InChI=1S/C19H30NO2S/c1-4-6-12-18(21)20(3)14-17(15(5-2)13-19(20)22)23-16-10-8-7-9-11-16/h7-11,15,17,19,22H,4-6,12-14H2,1-3H3/q+1 |
| InChIKey | QXUSOTLJPAYZIJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|