C11H14OS — CID 99864568
[(1R,2R)-2-phenylsulfanylcyclobutyl]methanol (PubChem CID 99864568) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is [(1R,2R)-2-phenylsulfanylcyclobutyl]methanol.
| Compound Name | [(1R,2R)-2-phenylsulfanylcyclobutyl]methanol |
|---|---|
| PubChem CID | 99864568 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | [(1R,2R)-2-phenylsulfanylcyclobutyl]methanol |
| SMILES | OC[C@H]1CC[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C11H14OS/c12-8-9-6-7-11(9)13-10-4-2-1-3-5-10/h1-5,9,11-12H,6-8H2/t9-,11-/m1/s1 |
| InChIKey | ZRBNJKPLWOMSFM-MWLCHTKSSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |