C14H14O5S-2 — CID 11899490
(1R,2R,4S,5R)-4-hydroxy-5-phenylsulfanylcyclohexane-1,2-dicarboxylate (PubChem CID 11899490) has the molecular formula C14H14O5S-2 and a molecular weight of 294.33 g/mol. Its IUPAC name is (1R,2R,4S,5R)-4-hydroxy-5-phenylsulfanylcyclohexane-1,2-dicarboxylate.
| Compound Name | (1R,2R,4S,5R)-4-hydroxy-5-phenylsulfanylcyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11899490 |
| Molecular Formula | C14H14O5S-2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (1R,2R,4S,5R)-4-hydroxy-5-phenylsulfanylcyclohexane-1,2-dicarboxylate |
| SMILES | O=C([O-])[C@@H]1C[C@H](O)[C@H](Sc2ccccc2)C[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C14H16O5S/c15-11-6-9(13(16)17)10(14(18)19)7-12(11)20-8-4-2-1-3-5-8/h1-5,9-12,15H,6-7H2,(H,16,17)(H,18,19)/p-2/t9-,10-,11+,12-/m1/s1 |
| InChIKey | AGCYWAFBTGJTPC-WISYIIOYSA-L |
| XLogP | -0.97 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |