C30H29NO2S — CID 134917561
N,N-dibenzyl-3-hydroxy-4-phenyl-2-phenylsulfanylbutanamide (PubChem CID 134917561) has the molecular formula C30H29NO2S and a molecular weight of 467.63 g/mol. Its IUPAC name is N,N-dibenzyl-3-hydroxy-4-phenyl-2-phenylsulfanylbutanamide.
| Compound Name | N,N-dibenzyl-3-hydroxy-4-phenyl-2-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 134917561 |
| Molecular Formula | C30H29NO2S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N,N-dibenzyl-3-hydroxy-4-phenyl-2-phenylsulfanylbutanamide |
| SMILES | O=C(C(Sc1ccccc1)C(O)Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H29NO2S/c32-28(21-24-13-5-1-6-14-24)29(34-27-19-11-4-12-20-27)30(33)31(22-25-15-7-2-8-16-25)23-26-17-9-3-10-18-26/h1-20,28-29,32H,21-23H2 |
| InChIKey | HSXBCKBDPDHLIH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |