C23H23NO2S — CID 101089525
(2S,3S)-N-benzyl-3-hydroxy-3-phenyl-2-(phenylsulfanylmethyl)propanamide (PubChem CID 101089525) has the molecular formula C23H23NO2S and a molecular weight of 377.51 g/mol. Its IUPAC name is (2S,3S)-N-benzyl-3-hydroxy-3-phenyl-2-(phenylsulfanylmethyl)propanamide.
| Compound Name | (2S,3S)-N-benzyl-3-hydroxy-3-phenyl-2-(phenylsulfanylmethyl)propanamide |
|---|---|
| PubChem CID | 101089525 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2S,3S)-N-benzyl-3-hydroxy-3-phenyl-2-(phenylsulfanylmethyl)propanamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](CSc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H23NO2S/c25-22(19-12-6-2-7-13-19)21(17-27-20-14-8-3-9-15-20)23(26)24-16-18-10-4-1-5-11-18/h1-15,21-22,25H,16-17H2,(H,24,26)/t21-,22+/m0/s1 |
| InChIKey | YTFYTDXWRWGNHP-FCHUYYIVSA-N |
| XLogP | 4.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |