C32H33NO2S — CID 14248362
S-phenyl (2R,3R,4S)-4-(dibenzylamino)-3-hydroxy-2-methyl-5-phenylpentanethioate (PubChem CID 14248362) has the molecular formula C32H33NO2S and a molecular weight of 495.69 g/mol. Its IUPAC name is S-phenyl (2R,3R,4S)-4-(dibenzylamino)-3-hydroxy-2-methyl-5-phenylpentanethioate.
| Compound Name | S-phenyl (2R,3R,4S)-4-(dibenzylamino)-3-hydroxy-2-methyl-5-phenylpentanethioate |
|---|---|
| PubChem CID | 14248362 |
| Molecular Formula | C32H33NO2S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | S-phenyl (2R,3R,4S)-4-(dibenzylamino)-3-hydroxy-2-methyl-5-phenylpentanethioate |
| SMILES | C[C@@H](C(=O)Sc1ccccc1)[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H33NO2S/c1-25(32(35)36-29-20-12-5-13-21-29)31(34)30(22-26-14-6-2-7-15-26)33(23-27-16-8-3-9-17-27)24-28-18-10-4-11-19-28/h2-21,25,30-31,34H,22-24H2,1H3/t25-,30+,31-/m1/s1 |
| InChIKey | UPVAHMXKFPVFFX-SDDUWZMOSA-N |
| XLogP | 6.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|