C26H37NO2S — CID 10071204
S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxy-6-methylheptanethioate (PubChem CID 10071204) has the molecular formula C26H37NO2S and a molecular weight of 427.65 g/mol. Its IUPAC name is S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxy-6-methylheptanethioate.
| Compound Name | S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxy-6-methylheptanethioate |
|---|---|
| PubChem CID | 10071204 |
| Molecular Formula | C26H37NO2S |
| Molecular Weight | 427.65 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxy-6-methylheptanethioate |
| SMILES | CC(C)C[C@@H]([C@H](O)CC(=O)SC(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H37NO2S/c1-20(2)16-23(24(28)17-25(29)30-26(3,4)5)27(18-21-12-8-6-9-13-21)19-22-14-10-7-11-15-22/h6-15,20,23-24,28H,16-19H2,1-5H3/t23-,24+/m0/s1 |
| InChIKey | LEVCXHOXLFJMHS-BJKOFHAPSA-N |
| XLogP | 5.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|