C23H31NO2S — CID 10091500
S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxypentanethioate (PubChem CID 10091500) has the molecular formula C23H31NO2S and a molecular weight of 385.57 g/mol. Its IUPAC name is S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxypentanethioate.
| Compound Name | S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxypentanethioate |
|---|---|
| PubChem CID | 10091500 |
| Molecular Formula | C23H31NO2S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxypentanethioate |
| SMILES | C[C@@H]([C@H](O)CC(=O)SC(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO2S/c1-18(21(25)15-22(26)27-23(2,3)4)24(16-19-11-7-5-8-12-19)17-20-13-9-6-10-14-20/h5-14,18,21,25H,15-17H2,1-4H3/t18-,21+/m0/s1 |
| InChIKey | WRTJAVPVDLZSJZ-GHTZIAJQSA-N |
| XLogP | 4.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|