C25H35NO2S — CID 10093182
S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate (PubChem CID 10093182) has the molecular formula C25H35NO2S and a molecular weight of 413.63 g/mol. Its IUPAC name is S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate.
| Compound Name | S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate |
|---|---|
| PubChem CID | 10093182 |
| Molecular Formula | C25H35NO2S |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | S-tert-butyl (3R,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate |
| SMILES | CC(C)[C@@H]([C@H](O)CC(=O)SC(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H35NO2S/c1-19(2)24(22(27)16-23(28)29-25(3,4)5)26(17-20-12-8-6-9-13-20)18-21-14-10-7-11-15-21/h6-15,19,22,24,27H,16-18H2,1-5H3/t22-,24+/m1/s1 |
| InChIKey | OSQMCAHOYFIXOL-VWNXMTODSA-N |
| XLogP | 5.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|