C26H29NO2 — CID 11292153
(4R,5S)-5-(dibenzylamino)-4-hydroxy-6-phenylhexan-2-one (PubChem CID 11292153) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (4R,5S)-5-(dibenzylamino)-4-hydroxy-6-phenylhexan-2-one.
| Compound Name | (4R,5S)-5-(dibenzylamino)-4-hydroxy-6-phenylhexan-2-one |
|---|---|
| PubChem CID | 11292153 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (4R,5S)-5-(dibenzylamino)-4-hydroxy-6-phenylhexan-2-one |
| SMILES | CC(=O)C[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-21(28)17-26(29)25(18-22-11-5-2-6-12-22)27(19-23-13-7-3-8-14-23)20-24-15-9-4-10-16-24/h2-16,25-26,29H,17-20H2,1H3/t25-,26+/m0/s1 |
| InChIKey | QDEYXLKFHPTHOR-IZZNHLLZSA-N |
| XLogP | 4.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |