C20H18F4N4O — CID 169319855
4-fluoro-1-[4-isocyano-3-(trifluoromethyl)phenyl]-N-(5-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 169319855) has the molecular formula C20H18F4N4O and a molecular weight of 406.38 g/mol. Its IUPAC name is 4-fluoro-1-[4-isocyano-3-(trifluoromethyl)phenyl]-N-(5-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 4-fluoro-1-[4-isocyano-3-(trifluoromethyl)phenyl]-N-(5-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 169319855 |
| Molecular Formula | C20H18F4N4O |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-fluoro-1-[4-isocyano-3-(trifluoromethyl)phenyl]-N-(5-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | [C-]#[N+]c1ccc(N2CCC(F)(C(=O)Nc3ccc(C)cn3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H18F4N4O/c1-13-3-6-17(26-12-13)27-18(29)19(21)7-9-28(10-8-19)14-4-5-16(25-2)15(11-14)20(22,23)24/h3-6,11-12H,7-10H2,1H3,(H,26,27,29) |
| InChIKey | CETGSZQYZHIOOS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|