About 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride
1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride (PubChem CID 169321688) has the molecular formula C9H8ClF6N
and a molecular weight of 279.61 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride |
| PubChem CID | 169321688 |
| Molecular Formula | C9H8ClF6N |
| Molecular Weight | 279.61 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride |
| SMILES | Cl.NC(c1cccc(C(F)F)c1F)C(F)(F)F |
| InChI | InChI=1S/C9H7F6N.ClH/c10-6-4(7(16)9(13,14)15)2-1-3-5(6)8(11)12;/h1-3,7-8H,16H2;1H |
| InChIKey | WTNDRXAKYLOGJM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride?
The IUPAC name of 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride (CID 169321688) is 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride.
What is the SMILES notation for 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride?
The canonical SMILES for 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride is Cl.NC(c1cccc(C(F)F)c1F)C(F)(F)F.
What is the InChIKey of 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride?
The InChIKey is WTNDRXAKYLOGJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F6N.ClH/c10-6-4(7(16)9(13,14)15)2-1-3-5(6)8(11)12;/h1-3,7-8H,16H2;1H.
What are the key properties of 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride?
1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride has a molecular weight of 279.61 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(difluoromethyl)-2-fluorophenyl]-2,2,2-trifluoroethanamine;hydrochloride is sourced from PubChem (CID 169321688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).