About CID 169322637
CID 169322637 (PubChem CID 169322637) has the molecular formula C64H56N4OSi2
and a molecular weight of 953.35 g/mol.
Molecular Properties
| Compound Name | CID 169322637 |
| PubChem CID | 169322637 |
| Molecular Formula | C64H56N4OSi2 |
| Molecular Weight | 953.35 g/mol |
| Exact Mass | 952.40 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccc(-c4ccc5c(c4)[Si](C)(C)CC[Si]5(C)C)cc3c3ccc(Oc4cccc(-n5[c-][n+]6c7c(cccc75)-c5ccccc5-c5ccccc5-c5ccccc5-6)c4)cc32)c1 |
| InChI | InChI=1S/C64H56N4OSi2/c1-64(2,3)44-32-33-65-62(38-44)68-57-30-26-42(43-27-31-60-61(37-43)71(6,7)35-34-70(60,4)5)36-55(57)53-29-28-47(40-59(53)68)69-46-17-14-16-45(39-46)66-41-67-56-24-13-12-22-52(56)50-20-10-8-18-48(50)49-19-9-11-21-51(49)54-23-15-25-58(66)63(54)67/h8-33,36-40H,34-35H2,1-7H3 |
| InChIKey | AMVWDIHGIYKETL-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 953.35 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 169322637 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169322637?
The IUPAC name of CID 169322637 (CID 169322637) is not available.
What is the SMILES notation for CID 169322637?
The canonical SMILES for CID 169322637 is CC(C)(C)c1ccnc(-n2c3ccc(-c4ccc5c(c4)[Si](C)(C)CC[Si]5(C)C)cc3c3ccc(Oc4cccc(-n5[c-][n+]6c7c(cccc75)-c5ccccc5-c5ccccc5-c5ccccc5-6)c4)cc32)c1.
What is the InChIKey of CID 169322637?
The InChIKey is AMVWDIHGIYKETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C64H56N4OSi2/c1-64(2,3)44-32-33-65-62(38-44)68-57-30-26-42(43-27-31-60-61(37-43)71(6,7)35-34-70(60,4)5)36-55(57)53-29-28-47(40-59(53)68)69-46-17-14-16-45(39-46)66-41-67-56-24-13-12-22-52(56)50-20-10-8-18-48(50)49-19-9-11-21-51(49)54-23-15-25-58(66)63(54)67/h8-33,36-40H,34-35H2,1-7H3.
What are the key properties of CID 169322637?
CID 169322637 has a molecular weight of 953.35 g/mol, XLogP of 15.12, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169322637 is sourced from PubChem (CID 169322637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).