About CID 171578879
CID 171578879 (PubChem CID 171578879) has the molecular formula C78H60N4O
and a molecular weight of 1069.36 g/mol.
Molecular Properties
| Compound Name | CID 171578879 |
| PubChem CID | 171578879 |
| Molecular Formula | C78H60N4O |
| Molecular Weight | 1069.36 g/mol |
| Exact Mass | 1068.48 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+]6c7c(cccc75)-c5ccccc5-c5ccccc5-c5ccc(-c7ccc8c(c7)C7(C)c9ccccc9C9(C)c%10ccccc%10C8(C)C97C)cc5-6)c4)cc32)c1 |
| InChI | InChI=1S/C78H60N4O/c1-74(2,3)50-40-41-79-72(44-50)82-68-32-17-12-26-58(68)60-38-36-53(46-71(60)82)83-52-21-18-20-51(45-52)80-47-81-70-43-49(34-37-59(70)56-24-10-8-22-54(56)55-23-9-11-25-57(55)61-27-19-33-69(80)73(61)81)48-35-39-66-67(42-48)77(6)65-31-16-15-30-64(65)75(4)62-28-13-14-29-63(62)76(66,5)78(75,77)7/h8-46H,1-7H3 |
| InChIKey | PIEYJILMKVVERV-UHFFFAOYSA-N |
| XLogP | 18.54 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 83 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1069.36 |
| LogP ≤ 5 | 18.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 171578879 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171578879?
The IUPAC name of CID 171578879 (CID 171578879) is not available.
What is the SMILES notation for CID 171578879?
The canonical SMILES for CID 171578879 is CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+]6c7c(cccc75)-c5ccccc5-c5ccccc5-c5ccc(-c7ccc8c(c7)C7(C)c9ccccc9C9(C)c%10ccccc%10C8(C)C97C)cc5-6)c4)cc32)c1.
What is the InChIKey of CID 171578879?
The InChIKey is PIEYJILMKVVERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C78H60N4O/c1-74(2,3)50-40-41-79-72(44-50)82-68-32-17-12-26-58(68)60-38-36-53(46-71(60)82)83-52-21-18-20-51(45-52)80-47-81-70-43-49(34-37-59(70)56-24-10-8-22-54(56)55-23-9-11-25-57(55)61-27-19-33-69(80)73(61)81)48-35-39-66-67(42-48)77(6)65-31-16-15-30-64(65)75(4)62-28-13-14-29-63(62)76(66,5)78(75,77)7/h8-46H,1-7H3.
What are the key properties of CID 171578879?
CID 171578879 has a molecular weight of 1069.36 g/mol, XLogP of 18.54, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171578879 is sourced from PubChem (CID 171578879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).