About 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile
3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile (PubChem CID 169324247) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile |
| PubChem CID | 169324247 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(C)C(O)(CC#N)C(C)(C)C |
| InChI | InChI=1S/C11H21NO/c1-9(2,3)11(13,7-8-12)10(4,5)6/h13H,7H2,1-6H3 |
| InChIKey | PQGDYAFFFDAGHE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile?
The IUPAC name of 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile (CID 169324247) is 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile.
What is the SMILES notation for 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile?
The canonical SMILES for 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile is CC(C)(C)C(O)(CC#N)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile?
The InChIKey is PQGDYAFFFDAGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-9(2,3)11(13,7-8-12)10(4,5)6/h13H,7H2,1-6H3.
What are the key properties of 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile?
3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile has a molecular weight of 183.29 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-3-hydroxy-4,4-dimethylpentanenitrile is sourced from PubChem (CID 169324247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).