C18H19N3OS — CID 169324654
(2S)-2-(N,4-dimethylanilino)-1-(1-thiophen-2-ylimidazol-2-yl)propan-1-one (PubChem CID 169324654) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is (2S)-2-(N,4-dimethylanilino)-1-(1-thiophen-2-ylimidazol-2-yl)propan-1-one.
| Compound Name | (2S)-2-(N,4-dimethylanilino)-1-(1-thiophen-2-ylimidazol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 169324654 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2S)-2-(N,4-dimethylanilino)-1-(1-thiophen-2-ylimidazol-2-yl)propan-1-one |
| SMILES | Cc1ccc(N(C)[C@@H](C)C(=O)c2nccn2-c2cccs2)cc1 |
| InChI | InChI=1S/C18H19N3OS/c1-13-6-8-15(9-7-13)20(3)14(2)17(22)18-19-10-11-21(18)16-5-4-12-23-16/h4-12,14H,1-3H3/t14-/m0/s1 |
| InChIKey | BJVUNEGGIFRECZ-AWEZNQCLSA-N |
| XLogP | 3.95 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|