C20H23N3O2S — CID 169324664
(2S)-2-[N-(3-methoxypropyl)anilino]-1-(1-thiophen-2-ylimidazol-2-yl)propan-1-one (PubChem CID 169324664) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is (2S)-2-[N-(3-methoxypropyl)anilino]-1-(1-thiophen-2-ylimidazol-2-yl)propan-1-one.
| Compound Name | (2S)-2-[N-(3-methoxypropyl)anilino]-1-(1-thiophen-2-ylimidazol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 169324664 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (2S)-2-[N-(3-methoxypropyl)anilino]-1-(1-thiophen-2-ylimidazol-2-yl)propan-1-one |
| SMILES | COCCCN(c1ccccc1)[C@@H](C)C(=O)c1nccn1-c1cccs1 |
| InChI | InChI=1S/C20H23N3O2S/c1-16(22(12-7-14-25-2)17-8-4-3-5-9-17)19(24)20-21-11-13-23(20)18-10-6-15-26-18/h3-6,8-11,13,15-16H,7,12,14H2,1-2H3/t16-/m0/s1 |
| InChIKey | VCHRIMZKQBPTDZ-INIZCTEOSA-N |
| XLogP | 4.05 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|