C6HBr2F2N3 — CID 169324782
1-azido-2,4-dibromo-3,5-difluorobenzene (PubChem CID 169324782) has the molecular formula C6HBr2F2N3 and a molecular weight of 312.90 g/mol. Its IUPAC name is 1-azido-2,4-dibromo-3,5-difluorobenzene.
| Compound Name | 1-azido-2,4-dibromo-3,5-difluorobenzene |
|---|---|
| PubChem CID | 169324782 |
| Molecular Formula | C6HBr2F2N3 |
| Molecular Weight | 312.90 g/mol |
| Exact Mass | 310.85 |
| IUPAC Name | 1-azido-2,4-dibromo-3,5-difluorobenzene |
| SMILES | [N-]=[N+]=Nc1cc(F)c(Br)c(F)c1Br |
| InChI | InChI=1S/C6HBr2F2N3/c7-4-2(9)1-3(12-13-11)5(8)6(4)10/h1H |
| InChIKey | LQOOJQLHCAJNDN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|