About 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene
1-azido-2,3-difluoro-5-methoxy-4-methylbenzene (PubChem CID 169326636) has the molecular formula C8H7F2N3O
and a molecular weight of 199.16 g/mol. Its IUPAC name is 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene.
Molecular Properties
| Compound Name | 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene |
| PubChem CID | 169326636 |
| Molecular Formula | C8H7F2N3O |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene |
| SMILES | COc1cc(N=[N+]=[N-])c(F)c(F)c1C |
| InChI | InChI=1S/C8H7F2N3O/c1-4-6(14-2)3-5(12-13-11)8(10)7(4)9/h3H,1-2H3 |
| InChIKey | PSKFHWRENJQIAB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene?
The IUPAC name of 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene (CID 169326636) is 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene.
What is the SMILES notation for 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene?
The canonical SMILES for 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene is COc1cc(N=[N+]=[N-])c(F)c(F)c1C.
What is the InChIKey of 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene?
The InChIKey is PSKFHWRENJQIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2N3O/c1-4-6(14-2)3-5(12-13-11)8(10)7(4)9/h3H,1-2H3.
What are the key properties of 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene?
1-azido-2,3-difluoro-5-methoxy-4-methylbenzene has a molecular weight of 199.16 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-2,3-difluoro-5-methoxy-4-methylbenzene is sourced from PubChem (CID 169326636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).