C9H9ClN4O — CID 169324899
2-azido-4-chloro-N,N-dimethylbenzamide (PubChem CID 169324899) has the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. Its IUPAC name is 2-azido-4-chloro-N,N-dimethylbenzamide.
| Compound Name | 2-azido-4-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 169324899 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-azido-4-chloro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1N=[N+]=[N-] |
| InChI | InChI=1S/C9H9ClN4O/c1-14(2)9(15)7-4-3-6(10)5-8(7)12-13-11/h3-5H,1-2H3 |
| InChIKey | FIORLNPHVHKCCF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|