C14H10Cl2N4O2 — CID 169326047
N-[4-(4-azido-2,6-dichlorophenoxy)phenyl]acetamide (PubChem CID 169326047) has the molecular formula C14H10Cl2N4O2 and a molecular weight of 337.17 g/mol. Its IUPAC name is N-[4-(4-azido-2,6-dichlorophenoxy)phenyl]acetamide.
| Compound Name | N-[4-(4-azido-2,6-dichlorophenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 169326047 |
| Molecular Formula | C14H10Cl2N4O2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-[4-(4-azido-2,6-dichlorophenoxy)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2c(Cl)cc(N=[N+]=[N-])cc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2N4O2/c1-8(21)18-9-2-4-11(5-3-9)22-14-12(15)6-10(19-20-17)7-13(14)16/h2-7H,1H3,(H,18,21) |
| InChIKey | LDRFPUXUZMXHLR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|