C21H15N5O3 — CID 169327842
4-amino-5-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169327842) has the molecular formula C21H15N5O3 and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-amino-5-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169327842 |
| Molecular Formula | C21H15N5O3 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-amino-5-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Cc1ccn2cc(-c3ccc(-n4c(N)c5c(cc4=O)C(=O)NC5=O)cc3)nc2c1 |
| InChI | InChI=1S/C21H15N5O3/c1-11-6-7-25-10-15(23-16(25)8-11)12-2-4-13(5-3-12)26-17(27)9-14-18(19(26)22)21(29)24-20(14)28/h2-10H,22H2,1H3,(H,24,28,29) |
| InChIKey | HZFYPNJMUQUNND-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|