C23H15N5O4 — CID 169327838
2-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]quinoline-4-carboxamide (PubChem CID 169327838) has the molecular formula C23H15N5O4 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 169327838 |
| Molecular Formula | C23H15N5O4 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]quinoline-4-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(-n3c(N)c4c(cc3=O)C(=O)NC4=O)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H15N5O4/c24-20-19-15(22(31)27-23(19)32)10-18(29)28(20)12-7-5-11(6-8-12)17-9-14(21(25)30)13-3-1-2-4-16(13)26-17/h1-10H,24H2,(H2,25,30)(H,27,31,32) |
| InChIKey | BZDIGFQDZIRSDL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|