C14H8N4O3S2 — CID 169327956
4-amino-5-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169327956) has the molecular formula C14H8N4O3S2 and a molecular weight of 344.38 g/mol. Its IUPAC name is 4-amino-5-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169327956 |
| Molecular Formula | C14H8N4O3S2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 4-amino-5-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc3[nH]c(=S)sc3c1)C(=O)NC2=O |
| InChI | InChI=1S/C14H8N4O3S2/c15-11-10-6(12(20)17-13(10)21)4-9(19)18(11)5-1-2-7-8(3-5)23-14(22)16-7/h1-4H,15H2,(H,16,22)(H,17,20,21) |
| InChIKey | HVHSKWOEDGLVSE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|