C21H13F3N4O4 — CID 169329964
N-[2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 169329964) has the molecular formula C21H13F3N4O4 and a molecular weight of 442.35 g/mol. Its IUPAC name is N-[2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 169329964 |
| Molecular Formula | C21H13F3N4O4 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | Nc1c2c(cc(=O)n1-c1ccccc1NC(=O)c1ccc(C(F)(F)F)cc1)C(=O)NC2=O |
| InChI | InChI=1S/C21H13F3N4O4/c22-21(23,24)11-7-5-10(6-8-11)18(30)26-13-3-1-2-4-14(13)28-15(29)9-12-16(17(28)25)20(32)27-19(12)31/h1-9H,25H2,(H,26,30)(H,27,31,32) |
| InChIKey | DRAIZYKSRMYKFI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|