C14H12N2O3 — CID 169335455
5-(1-methyl-2-oxo-3,4-dihydroquinazolin-8-yl)furan-2-carbaldehyde (PubChem CID 169335455) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-(1-methyl-2-oxo-3,4-dihydroquinazolin-8-yl)furan-2-carbaldehyde.
| Compound Name | 5-(1-methyl-2-oxo-3,4-dihydroquinazolin-8-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335455 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-(1-methyl-2-oxo-3,4-dihydroquinazolin-8-yl)furan-2-carbaldehyde |
| SMILES | CN1C(=O)NCc2cccc(-c3ccc(C=O)o3)c21 |
| InChI | InChI=1S/C14H12N2O3/c1-16-13-9(7-15-14(16)18)3-2-4-11(13)12-6-5-10(8-17)19-12/h2-6,8H,7H2,1H3,(H,15,18) |
| InChIKey | JYHKFHFGHVUEQV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|