C16H12N2O2S — CID 169336159
5-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169336159) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169336159 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(C3=CSC4=NCCN34)cc2)o1 |
| InChI | InChI=1S/C16H12N2O2S/c19-9-13-5-6-15(20-13)12-3-1-11(2-4-12)14-10-21-16-17-7-8-18(14)16/h1-6,9-10H,7-8H2 |
| InChIKey | JEMFUZGBJAEYKH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|