C20H26N6O2 — CID 169340063
tert-butyl 4-[2-[4-[2-(dicyanomethylidene)hydrazinyl]phenyl]ethyl]piperazine-1-carboxylate (PubChem CID 169340063) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[2-(dicyanomethylidene)hydrazinyl]phenyl]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[2-(dicyanomethylidene)hydrazinyl]phenyl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169340063 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | tert-butyl 4-[2-[4-[2-(dicyanomethylidene)hydrazinyl]phenyl]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCc2ccc(NN=C(C#N)C#N)cc2)CC1 |
| InChI | InChI=1S/C20H26N6O2/c1-20(2,3)28-19(27)26-12-10-25(11-13-26)9-8-16-4-6-17(7-5-16)23-24-18(14-21)15-22/h4-7,23H,8-13H2,1-3H3 |
| InChIKey | VALZWIXJSCTDBI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|