C14H13N5O — CID 169340557
2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340557) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340557 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccccc1CN1CCCC1=O |
| InChI | InChI=1S/C14H13N5O/c15-8-12(9-16)17-18-13-5-2-1-4-11(13)10-19-7-3-6-14(19)20/h1-2,4-5,18H,3,6-7,10H2 |
| InChIKey | PTFOQQFJRVYAPN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|