C10H3F2N5 — CID 169340874
2-[(2-cyano-3,4-difluorophenyl)hydrazinylidene]propanedinitrile (PubChem CID 169340874) has the molecular formula C10H3F2N5 and a molecular weight of 231.16 g/mol. Its IUPAC name is 2-[(2-cyano-3,4-difluorophenyl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(2-cyano-3,4-difluorophenyl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340874 |
| Molecular Formula | C10H3F2N5 |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-[(2-cyano-3,4-difluorophenyl)hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc(F)c(F)c1C#N |
| InChI | InChI=1S/C10H3F2N5/c11-8-1-2-9(7(5-15)10(8)12)17-16-6(3-13)4-14/h1-2,17H |
| InChIKey | DPVZNVLXOHYZLH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|