C11H5F3N6 — CID 169341585
2-[[2-(trifluoromethyl)-1H-benzimidazol-4-yl]hydrazinylidene]propanedinitrile (PubChem CID 169341585) has the molecular formula C11H5F3N6 and a molecular weight of 278.20 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)-1H-benzimidazol-4-yl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[2-(trifluoromethyl)-1H-benzimidazol-4-yl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169341585 |
| Molecular Formula | C11H5F3N6 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[[2-(trifluoromethyl)-1H-benzimidazol-4-yl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1cccc2[nH]c(C(F)(F)F)nc12 |
| InChI | InChI=1S/C11H5F3N6/c12-11(13,14)10-17-7-2-1-3-8(9(7)18-10)20-19-6(4-15)5-16/h1-3,20H,(H,17,18) |
| InChIKey | UIRHHOTXLBTPKN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|