C8H5F3N3O2- — CID 163774905
N-oxido-N-[2-(trifluoromethyl)-1H-benzimidazol-4-yl]hydroxylamine (PubChem CID 163774905) has the molecular formula C8H5F3N3O2- and a molecular weight of 232.14 g/mol. Its IUPAC name is N-oxido-N-[2-(trifluoromethyl)-1H-benzimidazol-4-yl]hydroxylamine.
| Compound Name | N-oxido-N-[2-(trifluoromethyl)-1H-benzimidazol-4-yl]hydroxylamine |
|---|---|
| PubChem CID | 163774905 |
| Molecular Formula | C8H5F3N3O2- |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N-oxido-N-[2-(trifluoromethyl)-1H-benzimidazol-4-yl]hydroxylamine |
| SMILES | [O-]N(O)c1cccc2[nH]c(C(F)(F)F)nc12 |
| InChI | InChI=1S/C8H5F3N3O2/c9-8(10,11)7-12-4-2-1-3-5(14(15)16)6(4)13-7/h1-3,15H,(H,12,13)/q-1 |
| InChIKey | UKSFDNKXJPKRSZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|