C15H8Cl2F3N3O2 — CID 54303424
N-(2,3-dichlorophenoxy)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide (PubChem CID 54303424) has the molecular formula C15H8Cl2F3N3O2 and a molecular weight of 390.15 g/mol. Its IUPAC name is N-(2,3-dichlorophenoxy)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(2,3-dichlorophenoxy)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 54303424 |
| Molecular Formula | C15H8Cl2F3N3O2 |
| Molecular Weight | 390.15 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | N-(2,3-dichlorophenoxy)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NOc1cccc(Cl)c1Cl)c1cccc2[nH]c(C(F)(F)F)nc12 |
| InChI | InChI=1S/C15H8Cl2F3N3O2/c16-8-4-2-6-10(11(8)17)25-23-13(24)7-3-1-5-9-12(7)22-14(21-9)15(18,19)20/h1-6H,(H,21,22)(H,23,24) |
| InChIKey | SFVCVHFLAKTAFS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.15 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|