C26H18F6N4O6S2 — CID 171929578
naphthalene-1,5-disulfonic acid;bis(2-(trifluoromethyl)-1H-benzimidazole) (PubChem CID 171929578) has the molecular formula C26H18F6N4O6S2 and a molecular weight of 660.57 g/mol. Its IUPAC name is naphthalene-1,5-disulfonic acid;bis(2-(trifluoromethyl)-1H-benzimidazole).
| Compound Name | naphthalene-1,5-disulfonic acid;bis(2-(trifluoromethyl)-1H-benzimidazole) |
|---|---|
| PubChem CID | 171929578 |
| Molecular Formula | C26H18F6N4O6S2 |
| Molecular Weight | 660.57 g/mol |
| Exact Mass | 660.06 |
| IUPAC Name | naphthalene-1,5-disulfonic acid;bis(2-(trifluoromethyl)-1H-benzimidazole) |
| SMILES | FC(F)(F)c1nc2ccccc2[nH]1.FC(F)(F)c1nc2ccccc2[nH]1.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C10H8O6S2.2C8H5F3N2/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;2*9-8(10,11)7-12-5-3-1-2-4-6(5)13-7/h1-6H,(H,11,12,13)(H,14,15,16);2*1-4H,(H,12,13) |
| InChIKey | SVWIYYKASZTLAU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 166.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|