C17H8F8O3S — CID 87521196
naphthalene-1-sulfonic acid;1,2,3,4,5-pentafluoro-6-(trifluoromethyl)benzene (PubChem CID 87521196) has the molecular formula C17H8F8O3S and a molecular weight of 444.30 g/mol. Its IUPAC name is naphthalene-1-sulfonic acid;1,2,3,4,5-pentafluoro-6-(trifluoromethyl)benzene.
| Compound Name | naphthalene-1-sulfonic acid;1,2,3,4,5-pentafluoro-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 87521196 |
| Molecular Formula | C17H8F8O3S |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | naphthalene-1-sulfonic acid;1,2,3,4,5-pentafluoro-6-(trifluoromethyl)benzene |
| SMILES | Fc1c(F)c(F)c(C(F)(F)F)c(F)c1F.O=S(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O3S.C7F8/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;8-2-1(7(13,14)15)3(9)5(11)6(12)4(2)10/h1-7H,(H,11,12,13); |
| InChIKey | JFGNXAGDKKTXCJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|