C8H5F2N2O3S- — CID 5047631
1H-benzimidazol-2-yl(difluoro)methanesulfonate (PubChem CID 5047631) has the molecular formula C8H5F2N2O3S- and a molecular weight of 247.20 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl(difluoro)methanesulfonate.
| Compound Name | 1H-benzimidazol-2-yl(difluoro)methanesulfonate |
|---|---|
| PubChem CID | 5047631 |
| Molecular Formula | C8H5F2N2O3S- |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 1H-benzimidazol-2-yl(difluoro)methanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H6F2N2O3S/c9-8(10,16(13,14)15)7-11-5-3-1-2-4-6(5)12-7/h1-4H,(H,11,12)(H,13,14,15)/p-1 |
| InChIKey | LSVGNKDYGSHAGU-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|