C9H11N3S2 — CID 57302546
1-amino-1-(1H-benzimidazol-2-yl)ethane-1,2-dithiol (PubChem CID 57302546) has the molecular formula C9H11N3S2 and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-amino-1-(1H-benzimidazol-2-yl)ethane-1,2-dithiol.
| Compound Name | 1-amino-1-(1H-benzimidazol-2-yl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 57302546 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1-amino-1-(1H-benzimidazol-2-yl)ethane-1,2-dithiol |
| SMILES | NC(S)(CS)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H11N3S2/c10-9(14,5-13)8-11-6-3-1-2-4-7(6)12-8/h1-4,13-14H,5,10H2,(H,11,12) |
| InChIKey | PNKDKWBRHZPQDF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|