C15H5F17N2O2 — CID 98047967
2-[(1S)-1,2,2,2-tetrafluoro-1-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1H-benzimidazole (PubChem CID 98047967) has the molecular formula C15H5F17N2O2 and a molecular weight of 568.18 g/mol. Its IUPAC name is 2-[(1S)-1,2,2,2-tetrafluoro-1-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1H-benzimidazole.
| Compound Name | 2-[(1S)-1,2,2,2-tetrafluoro-1-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 98047967 |
| Molecular Formula | C15H5F17N2O2 |
| Molecular Weight | 568.18 g/mol |
| Exact Mass | 568.01 |
| IUPAC Name | 2-[(1S)-1,2,2,2-tetrafluoro-1-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1H-benzimidazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)O[C@@](F)(C(F)(F)F)C(F)(F)O[C@](F)(c1nc2ccccc2[nH]1)C(F)(F)F |
| InChI | InChI=1S/C15H5F17N2O2/c16-8(11(20,21)22,7-33-5-3-1-2-4-6(5)34-7)35-15(31,32)10(19,13(26,27)28)36-14(29,30)9(17,18)12(23,24)25/h1-4H,(H,33,34)/t8-,10+/m1/s1 |
| InChIKey | HPWPTXMMPBCRFQ-SCZZXKLOSA-N |
| XLogP | 6.89 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.18 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|