C12H8FN7O — CID 169346001
3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346001) has the molecular formula C12H8FN7O and a molecular weight of 285.24 g/mol. Its IUPAC name is 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346001 |
| Molecular Formula | C12H8FN7O |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(F)c2c(c1)C(=O)NC2)c1nn[nH]n1 |
| InChI | InChI=1S/C12H8FN7O/c13-10-2-7(1-8-9(10)5-16-12(8)21)15-4-6(3-14)11-17-19-20-18-11/h1-2,4,15H,5H2,(H,16,21)(H,17,18,19,20) |
| InChIKey | VTBHZFOSWLFTKN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|