About 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile
3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346001) has the molecular formula C12H8FN7O
and a molecular weight of 285.24 g/mol. Its IUPAC name is 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| PubChem CID | 169346001 |
| Molecular Formula | C12H8FN7O |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(F)c2c(c1)C(=O)NC2)c1nn[nH]n1 |
| InChI | InChI=1S/C12H8FN7O/c13-10-2-7(1-8-9(10)5-16-12(8)21)15-4-6(3-14)11-17-19-20-18-11/h1-2,4,15H,5H2,(H,16,21)(H,17,18,19,20) |
| InChIKey | VTBHZFOSWLFTKN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile?
The IUPAC name of 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (CID 169346001) is 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
What is the SMILES notation for 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile?
The canonical SMILES for 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile is N#CC(=CNc1cc(F)c2c(c1)C(=O)NC2)c1nn[nH]n1.
What is the InChIKey of 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile?
The InChIKey is VTBHZFOSWLFTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FN7O/c13-10-2-7(1-8-9(10)5-16-12(8)21)15-4-6(3-14)11-17-19-20-18-11/h1-2,4,15H,5H2,(H,16,21)(H,17,18,19,20).
What are the key properties of 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile?
3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile has a molecular weight of 285.24 g/mol, XLogP of 0.56, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile is sourced from PubChem (CID 169346001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).