C16H22N2O6S — CID 169354714
2-isocyanato-4-(octoxycarbonylamino)benzenesulfonic acid (PubChem CID 169354714) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-isocyanato-4-(octoxycarbonylamino)benzenesulfonic acid.
| Compound Name | 2-isocyanato-4-(octoxycarbonylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 169354714 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-isocyanato-4-(octoxycarbonylamino)benzenesulfonic acid |
| SMILES | CCCCCCCCOC(=O)Nc1ccc(S(=O)(=O)O)c(N=C=O)c1 |
| InChI | InChI=1S/C16H22N2O6S/c1-2-3-4-5-6-7-10-24-16(20)18-13-8-9-15(25(21,22)23)14(11-13)17-12-19/h8-9,11H,2-7,10H2,1H3,(H,18,20)(H,21,22,23) |
| InChIKey | JVOSBAIQLOQKIR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|