C15H22BrNO5S — CID 169336937
2-bromo-4-(octoxycarbonylamino)benzenesulfonic acid (PubChem CID 169336937) has the molecular formula C15H22BrNO5S and a molecular weight of 408.31 g/mol. Its IUPAC name is 2-bromo-4-(octoxycarbonylamino)benzenesulfonic acid.
| Compound Name | 2-bromo-4-(octoxycarbonylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 169336937 |
| Molecular Formula | C15H22BrNO5S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 2-bromo-4-(octoxycarbonylamino)benzenesulfonic acid |
| SMILES | CCCCCCCCOC(=O)Nc1ccc(S(=O)(=O)O)c(Br)c1 |
| InChI | InChI=1S/C15H22BrNO5S/c1-2-3-4-5-6-7-10-22-15(18)17-12-8-9-14(13(16)11-12)23(19,20)21/h8-9,11H,2-7,10H2,1H3,(H,17,18)(H,19,20,21) |
| InChIKey | RIHLWFGJXOTWCY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|