C9H8N4OS — CID 169355998
[4-(1,3,4-oxadiazol-2-yl)phenyl]thiourea (PubChem CID 169355998) has the molecular formula C9H8N4OS and a molecular weight of 220.26 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl]thiourea.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 169355998 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C9H8N4OS/c10-9(15)12-7-3-1-6(2-4-7)8-13-11-5-14-8/h1-5H,(H3,10,12,15) |
| InChIKey | KSJJOWBVOOIDAD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|