C14H16N4O2 — CID 61275565
N-[4-(1,3,4-oxadiazol-2-yl)phenyl]piperidine-4-carboxamide (PubChem CID 61275565) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-[4-(1,3,4-oxadiazol-2-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(1,3,4-oxadiazol-2-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 61275565 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[4-(1,3,4-oxadiazol-2-yl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nnco2)cc1)C1CCNCC1 |
| InChI | InChI=1S/C14H16N4O2/c19-13(10-5-7-15-8-6-10)17-12-3-1-11(2-4-12)14-18-16-9-20-14/h1-4,9-10,15H,5-8H2,(H,17,19) |
| InChIKey | XRBGIRKEACXGNE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |