C10H12N4OS — CID 169356684
[2-(1-hydroxyethyl)-3H-benzimidazol-5-yl]thiourea (PubChem CID 169356684) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is [2-(1-hydroxyethyl)-3H-benzimidazol-5-yl]thiourea.
| Compound Name | [2-(1-hydroxyethyl)-3H-benzimidazol-5-yl]thiourea |
|---|---|
| PubChem CID | 169356684 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [2-(1-hydroxyethyl)-3H-benzimidazol-5-yl]thiourea |
| SMILES | CC(O)c1nc2ccc(NC(N)=S)cc2[nH]1 |
| InChI | InChI=1S/C10H12N4OS/c1-5(15)9-13-7-3-2-6(12-10(11)16)4-8(7)14-9/h2-5,15H,1H3,(H,13,14)(H3,11,12,16) |
| InChIKey | UQMXUBMXQVJKAU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|