C10H14N2OS — CID 169357786
(4-methoxy-2,3-dimethylphenyl)thiourea (PubChem CID 169357786) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is (4-methoxy-2,3-dimethylphenyl)thiourea.
| Compound Name | (4-methoxy-2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 169357786 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (4-methoxy-2,3-dimethylphenyl)thiourea |
| SMILES | COc1ccc(NC(N)=S)c(C)c1C |
| InChI | InChI=1S/C10H14N2OS/c1-6-7(2)9(13-3)5-4-8(6)12-10(11)14/h4-5H,1-3H3,(H3,11,12,14) |
| InChIKey | FYSCEZNBMOLHRD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|