C9H8N4O2S — CID 169357904
6-(carbamothioylamino)-3H-benzimidazole-5-carboxylic acid (PubChem CID 169357904) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 6-(carbamothioylamino)-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 6-(carbamothioylamino)-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 169357904 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 6-(carbamothioylamino)-3H-benzimidazole-5-carboxylic acid |
| SMILES | NC(=S)Nc1cc2nc[nH]c2cc1C(=O)O |
| InChI | InChI=1S/C9H8N4O2S/c10-9(16)13-5-2-7-6(11-3-12-7)1-4(5)8(14)15/h1-3H,(H,11,12)(H,14,15)(H3,10,13,16) |
| InChIKey | PRSYRWPFTORSLZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|