C9H10Cl2N8 — CID 70627804
2-chloro-1-[6-[(N'-chlorocarbamimidoyl)amino]-1H-benzimidazol-5-yl]guanidine (PubChem CID 70627804) has the molecular formula C9H10Cl2N8 and a molecular weight of 301.14 g/mol. Its IUPAC name is 2-chloro-1-[6-[(N'-chlorocarbamimidoyl)amino]-1H-benzimidazol-5-yl]guanidine.
| Compound Name | 2-chloro-1-[6-[(N'-chlorocarbamimidoyl)amino]-1H-benzimidazol-5-yl]guanidine |
|---|---|
| PubChem CID | 70627804 |
| Molecular Formula | C9H10Cl2N8 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-chloro-1-[6-[(N'-chlorocarbamimidoyl)amino]-1H-benzimidazol-5-yl]guanidine |
| SMILES | NC(=NCl)Nc1cc2nc[nH]c2cc1NC(N)=NCl |
| InChI | InChI=1S/C9H10Cl2N8/c10-18-8(12)16-6-1-4-5(15-3-14-4)2-7(6)17-9(13)19-11/h1-3H,(H,14,15)(H3,12,16,18)(H3,13,17,19) |
| InChIKey | MZEBVRAKOHNGAE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|