C8H7ClN2O — CID 130882807
(6-chloro-3H-benzimidazol-5-yl)methanol (PubChem CID 130882807) has the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. Its IUPAC name is (6-chloro-3H-benzimidazol-5-yl)methanol.
| Compound Name | (6-chloro-3H-benzimidazol-5-yl)methanol |
|---|---|
| PubChem CID | 130882807 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | (6-chloro-3H-benzimidazol-5-yl)methanol |
| SMILES | OCc1cc2[nH]cnc2cc1Cl |
| InChI | InChI=1S/C8H7ClN2O/c9-6-2-8-7(10-4-11-8)1-5(6)3-12/h1-2,4,12H,3H2,(H,10,11) |
| InChIKey | DHRHUDFMFFGBMZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |